CAS 197634-45-0 appears in our catalog under these names: 1,2-Dichloro-3-isopropoxybenzene, 98%, 1,2-Dichloro-3-isopropoxybenzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,2-dichloro-3-propan-2-yloxybenzene (CAS 197634-45-0) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: 1,2-dichloro-3-propan-2-yloxybenzene. InChIKey: PCTCKKKDHQQCCL-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 1,2-dichloro-3-propan-2-yloxybenzene |
| InChIKey | PCTCKKKDHQQCCL-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)