CAS 1369848-30-5 is the registry number for 1,4-Dichloro-2-(propan-2-yloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,4-dichloro-2-propan-2-yloxybenzene (CAS 1369848-30-5) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: 1,4-dichloro-2-propan-2-yloxybenzene. InChIKey: LLPFQJLKFDPDKS-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 1,4-dichloro-2-propan-2-yloxybenzene |
| InChIKey | LLPFQJLKFDPDKS-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)