cas: 20802-15-7 — see every product listed under this CAS number, including other names
1-(3,4-Dimethoxyphenyl)cyclopropanecarbonitrile, ≥95%, ≥95% (CAS 20802-15-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JGF-50mg |
| cas | 20802-15-7 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 1902.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(3,4-dimethoxyphenyl)cyclopropane-1-carbonitrile (CAS 20802-15-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)cyclopropane-1-carbonitrile. InChIKey: PZVYROVODMATJD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)cyclopropane-1-carbonitrile |
| InChIKey | PZVYROVODMATJD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2(CC2)C#N)OC |
Computed by PubChem (NCBI)