CAS 7479-20-1 appears in our catalog under these names: 3-(1-Methyl-1h-indol-3-yl)propanoic acid, 98%, 3-(1-Methyl-1H-indol-3-yl)propanoic acid, 3-(1-Methyl-1H-indol-3-yl)propanoic acid, 98%, 98%, 3-(1-Methyl-1H-indol-3-yl)-propionic acid. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 500mg, 1000mg, 2000mg, 5000mg.
3-(1-methylindol-3-yl)propanoic acid (CAS 7479-20-1) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 3-(1-methylindol-3-yl)propanoic acid. InChIKey: VVKVBQDZJLGAFG-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 3-(1-methylindol-3-yl)propanoic acid |
| InChIKey | VVKVBQDZJLGAFG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)CCC(=O)O |
Computed by PubChem (NCBI)