CAS 6854-17-7 is the registry number for 2,5,7-Trimethylquinolin-8-ol 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,5,7-trimethyl-1-oxidoquinolin-1-ium-8-ol (CAS 6854-17-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 2,5,7-trimethyl-1-oxidoquinolin-1-ium-8-ol. InChIKey: GZACHBOFTJXUOV-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2,5,7-trimethyl-1-oxidoquinolin-1-ium-8-ol |
| InChIKey | GZACHBOFTJXUOV-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=C(C=C1)C(=CC(=C2O)C)C)[O-] |
Computed by PubChem (NCBI)