cas: 852227-94-2 — see every product listed under this CAS number, including other names
1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole 96% (CAS 852227-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A867678-100mg |
| cas | 852227-94-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 281.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A867678 |
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (CAS 852227-94-2) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole. InChIKey: GVSCNAOZDQCWJJ-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| InChIKey | GVSCNAOZDQCWJJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N3C=CC=N3 |
Computed by PubChem (NCBI)