cas: 852227-94-2 — see every product listed under this CAS number, including other names
1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaboranlan-2-yl)phenyl]-1H-pyrazole, 97% (CAS 852227-94-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065556-1G |
| cas | 852227-94-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 10g | 1565.09 Pln | |
| Fluorochem | 25g | 3215.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (CAS 852227-94-2) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole. InChIKey: GVSCNAOZDQCWJJ-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| InChIKey | GVSCNAOZDQCWJJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N3C=CC=N3 |
Computed by PubChem (NCBI)