cas: 1201657-84-2 — see every product listed under this CAS number, including other names
1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea 98% (CAS 1201657-84-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231737-100mg |
| cas | 1201657-84-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 548.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A231737 |
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 1201657-84-2) is a chemical compound with the molecular formula C13H19BN2O3 and a molecular weight of 262.11 g/mol. IUPAC name: [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: UJZINFWQGAGUNY-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O3 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | UJZINFWQGAGUNY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)N |
Computed by PubChem (NCBI)