CAS 1191063-60-1 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (CAS 1191063-60-1) is a chemical compound with the molecular formula C13H19BN2O3 and a molecular weight of 262.11 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide. InChIKey: LZTWONJSXRKQGA-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O3 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| InChIKey | LZTWONJSXRKQGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)