CAS 877134-77-5 appears in our catalog under these names: 4-(Ureido)phenylboronic acid, pinacol ester, 98%, 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 877134-77-5) is a chemical compound with the molecular formula C13H19BN2O3 and a molecular weight of 262.11 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: BVWCMMVUJQHJJE-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O3 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | BVWCMMVUJQHJJE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)N |
Computed by PubChem (NCBI)