cas: 14347-15-0 — see every product listed under this CAS number, including other names
1-(3-Amino-4-(benzyloxy)phenyl)ethanone, 95%, 95% (CAS 14347-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118K3J-100mg |
| cas | 14347-15-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 731.60 Pln | |
| Chemat | 250mg | 1067.60 Pln | |
| Chemat | 1g | 2579.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-amino-4-phenylmethoxyphenyl)ethanone (CAS 14347-15-0) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 1-(3-amino-4-phenylmethoxyphenyl)ethanone. InChIKey: CALRVTMJQJSQEW-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 1-(3-amino-4-phenylmethoxyphenyl)ethanone |
| InChIKey | CALRVTMJQJSQEW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)