cas: 53534-14-8 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)-1H-pyrrole-2,5-dione, 97% (CAS 53534-14-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 3g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F241511-250MG |
| cas | 53534-14-8 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 2.5g | 523.79 Pln | |
| Fluorochem | 3g | 586.27 Pln | |
| Fluorochem | 5g | 773.70 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| Ambeed | 10g | 1232.56 Pln | |
| Ambeed | 25g | 2400.69 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-(3-bromophenyl)pyrrole-2,5-dione (CAS 53534-14-8) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 1-(3-bromophenyl)pyrrole-2,5-dione. InChIKey: KJJYDECLTBAKCK-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 1-(3-bromophenyl)pyrrole-2,5-dione |
| InChIKey | KJJYDECLTBAKCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)