cas: 14088-96-1 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)tetrahydro-2H-imidazol-2-one, 98%, 98% (CAS 14088-96-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CZ3-1g |
| cas | 14088-96-1 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 597.20 Pln | |
| Chemat | 5g | 2306.00 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromophenyl)imidazolidin-2-one (CAS 14088-96-1) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 1-(3-bromophenyl)imidazolidin-2-one. InChIKey: YWUYVOVMNCGEQZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 1-(3-bromophenyl)imidazolidin-2-one |
| InChIKey | YWUYVOVMNCGEQZ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)N1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)