CAS 951885-74-8 appears in our catalog under these names: 2-Bromo-N-cyclopropylisonicotinamide, 98%, 2-Bromo-N-cyclopropylisonicotinamide, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
2-bromo-N-cyclopropylpyridine-4-carboxamide (CAS 951885-74-8) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 2-bromo-N-cyclopropylpyridine-4-carboxamide. InChIKey: AYNACGIRZWTSCN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 2-bromo-N-cyclopropylpyridine-4-carboxamide |
| InChIKey | AYNACGIRZWTSCN-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=NC=C2)Br |
Computed by PubChem (NCBI)