CAS 396725-95-4 appears in our catalog under these names: 6-Bromo-1-ethyl-3H-1,3-benzodiazol-2-one, 95%, 6-Bromo-1-ethyl-1,3-dihydro-2H-benzo(d)imidazol-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-bromo-3-ethyl-1H-benzimidazol-2-one (CAS 396725-95-4) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-3-ethyl-1H-benzimidazol-2-one. InChIKey: LDHWUSAFYVQSFB-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-3-ethyl-1H-benzimidazol-2-one |
| InChIKey | LDHWUSAFYVQSFB-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=CC(=C2)Br)NC1=O |
Computed by PubChem (NCBI)