cas: 939760-06-2 — see every product listed under this CAS number, including other names
1-(3-Chlorobenzyl)-1,2,3,4-tetrahydroquinoxaline, 95%, 95% (CAS 939760-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CWP-100mg |
| cas | 939760-06-2 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1302.80 Pln | |
| Chemat | 5g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[(3-chlorophenyl)methyl]-2,3-dihydro-1H-quinoxaline (CAS 939760-06-2) is a chemical compound with the molecular formula C15H15ClN2 and a molecular weight of 258.74 g/mol. IUPAC name: 4-[(3-chlorophenyl)methyl]-2,3-dihydro-1H-quinoxaline. InChIKey: ZDHMFMMGYDCLAL-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | 4-[(3-chlorophenyl)methyl]-2,3-dihydro-1H-quinoxaline |
| InChIKey | ZDHMFMMGYDCLAL-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C2N1)CC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)