CAS 1104027-46-4 appears in our catalog under these names: 2-Benzyl-5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine hydrochloride, 97%, 5-Chloro-1,2,3,4-tetrahydro-2-(phenylmethyl)-2,6-naphthyridine, 2-Benzyl-5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine, 95%, 2-Benzyl-5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
2-benzyl-5-chloro-3,4-dihydro-1H-2,6-naphthyridine (CAS 1104027-46-4) is a chemical compound with the molecular formula C15H15ClN2 and a molecular weight of 258.74 g/mol. IUPAC name: 2-benzyl-5-chloro-3,4-dihydro-1H-2,6-naphthyridine. InChIKey: IUQVIIUHJIPKQK-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | 2-benzyl-5-chloro-3,4-dihydro-1H-2,6-naphthyridine |
| InChIKey | IUQVIIUHJIPKQK-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=NC=C2)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)