CAS 939760-06-2 appears in our catalog under these names: 1-(3-Chlorobenzyl)-1,2,3,4-tetrahydroquinoxaline dihydrochloride, 95%, 1–(3–Chlorobenzyl)–1,2,3,4–tetrahydroquinoxaline, 1-(3-Chlorobenzyl)-1,2,3,4-tetrahydroquinoxaline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 50mg, 100mg.
4-[(3-chlorophenyl)methyl]-2,3-dihydro-1H-quinoxaline (CAS 939760-06-2) is a chemical compound with the molecular formula C15H15ClN2 and a molecular weight of 258.74 g/mol. IUPAC name: 4-[(3-chlorophenyl)methyl]-2,3-dihydro-1H-quinoxaline. InChIKey: ZDHMFMMGYDCLAL-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | 4-[(3-chlorophenyl)methyl]-2,3-dihydro-1H-quinoxaline |
| InChIKey | ZDHMFMMGYDCLAL-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C2N1)CC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)