CAS 62780-89-6 appears in our catalog under these names: Domperidone Impurity 1, Domperidone Impurity 15(Dom-2), 1-(3-Chloropropyl)-1,3-dihydrobenzimidazol-2-one (>85%), 1-(3-Chloropropyl)-1,3dihydrobenzimidazol-2-one (~90%), 1-(3-Chloropropyl)-1,3-dihydro-2H-benzimidazol-2-one. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Fluorochem. Available pack sizes: on request, 100g, 10g, 25mg, 50g, 25g, 250g, 500g.
3-(3-chloropropyl)-1H-benzimidazol-2-one (CAS 62780-89-6) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 3-(3-chloropropyl)-1H-benzimidazol-2-one. InChIKey: GUMPYDGUYXOYML-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 3-(3-chloropropyl)-1H-benzimidazol-2-one |
| InChIKey | GUMPYDGUYXOYML-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)N2CCCCl |
Computed by PubChem (NCBI)