Products 197967-66-1
CAS 197967-66-1 appears in our catalog under these names: 1-(2-Chlorophenyl)piperazin-2-one, 95%, 1-(2-Chlorophenyl)piperazin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(2-chlorophenyl)piperazin-2-one (CAS 197967-66-1) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 1-(2-chlorophenyl)piperazin-2-one. InChIKey: QMIBLRDYVHXODO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 1-(2-chlorophenyl)piperazin-2-one |
| InChIKey | QMIBLRDYVHXODO-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)