CAS 64614-47-7 is the registry number for 2-Chloro-5-[(pyrrolidin-1-yl)carbonyl]pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
(6-chloro-3-pyridinyl)-pyrrolidin-1-ylmethanone (CAS 64614-47-7) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: (6-chloro-3-pyridinyl)-pyrrolidin-1-ylmethanone. InChIKey: XLCWRTHBRZQKJL-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | (6-chloro-3-pyridinyl)-pyrrolidin-1-ylmethanone |
| InChIKey | XLCWRTHBRZQKJL-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)