cas: 1807685-51-3 — see every product listed under this CAS number, including other names
1-(3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-one, 95% (CAS 1807685-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A739943-250mg |
| cas | 1807685-51-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1371.62 Pln | |
| Ambeed | 5g | 3702.31 Pln | |
| Ambeed | 10g | 5165.25 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2541.20 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 558.72 Pln | |
| BLDpharm | 1g | 1475.06 Pln | |
| BLDpharm | 5g | 3985.29 Pln | |
| BLDpharm | 10g | 5562.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1807685-51-3) is a chemical compound with the molecular formula C14H18BFO3 and a molecular weight of 264.10 g/mol. IUPAC name: 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: QRPSPYZFNHVURF-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO3 |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | QRPSPYZFNHVURF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)C)F |
Computed by PubChem (NCBI)