CAS 3050888-31-5 appears in our catalog under these names: 3-Acetyl-4-fluorophenylboronic acid pinacol ester, 97%, 97%, 1-(2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 3050888-31-5) is a chemical compound with the molecular formula C14H18BFO3 and a molecular weight of 264.10 g/mol. IUPAC name: 1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: IVMOIRWSKRDUGZ-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO3 |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 1-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | IVMOIRWSKRDUGZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)C(=O)C |
Computed by PubChem (NCBI)