CAS 2377610-69-8 is the registry number for 1-[5-Fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 2377610-69-8) is a chemical compound with the molecular formula C14H18BFO3 and a molecular weight of 264.10 g/mol. IUPAC name: 1-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: MZUJUYOBCWNTNI-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO3 |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 1-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | MZUJUYOBCWNTNI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)C(=O)C |
Computed by PubChem (NCBI)