cas: 6968-76-9 — see every product listed under this CAS number, including other names
1-(3-Methoxyphenyl)piperazine dihydrochloride, 98%, 98% (CAS 6968-76-9) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CXG-50g |
| cas | 6968-76-9 |
| size | 50g |
| availability | 750g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 208.40 Pln | |
| Chemat | 250g | 750.80 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 342.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(3-methoxyphenyl)piperazine;dihydrochloride (CAS 6968-76-9) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: 1-(3-methoxyphenyl)piperazine;dihydrochloride. InChIKey: UKUNKQNESKRETR-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)piperazine;dihydrochloride |
| InChIKey | UKUNKQNESKRETR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)