Products 2169998-43-8

CAS 2169998-43-8 is the registry number for 1-Methyl-4-(4-piperidinyl)-2(1h)-pyridinone dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 250mg, 5g.

Structural formula: {0} (CAS {1})

1-methyl-4-piperidin-4-ylpyridin-2-one;dihydrochloride (CAS 2169998-43-8) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: 1-methyl-4-piperidin-4-ylpyridin-2-one;dihydrochloride. InChIKey: UQKKGHLVOPEPLI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18Cl2N2O
Molecular weight265.18 g/mol
IUPAC name1-methyl-4-piperidin-4-ylpyridin-2-one;dihydrochloride
InChIKeyUQKKGHLVOPEPLI-UHFFFAOYSA-N
SMILESCN1C=CC(=CC1=O)C2CCNCC2.Cl.Cl

Computed by PubChem (NCBI)