Products 2248202-39-1
CAS 2248202-39-1 appears in our catalog under these names: [(2S)-4-phenylmorpholin-2-yl]methanamine dihydrochloride, 95%, (S)-(4-Phenylmorpholin-2-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
[(2S)-4-phenylmorpholin-2-yl]methanamine;dihydrochloride (CAS 2248202-39-1) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: [(2S)-4-phenylmorpholin-2-yl]methanamine;dihydrochloride. InChIKey: AVRFOYGLSVJGGS-IDMXKUIJSA-N.
| Molecular formula | C11H18Cl2N2O |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | [(2S)-4-phenylmorpholin-2-yl]methanamine;dihydrochloride |
| InChIKey | AVRFOYGLSVJGGS-IDMXKUIJSA-N |
| SMILES | C1CO[C@H](CN1C2=CC=CC=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)