cas: 198281-54-8 — see every product listed under this CAS number, including other names
1-(3-NITROBENZYL)-4-METHYLPIPERAZINE, 97% (CAS 198281-54-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474792-1G |
| cas | 198281-54-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 633.13 Pln | |
| Fluorochem | 10g | 1216.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-methyl-4-[(3-nitrophenyl)methyl]piperazine (CAS 198281-54-8) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: 1-methyl-4-[(3-nitrophenyl)methyl]piperazine. InChIKey: QXWROCIDLCOGKL-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-methyl-4-[(3-nitrophenyl)methyl]piperazine |
| InChIKey | QXWROCIDLCOGKL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)