CAS 19577-82-3 is the registry number for 1-(2-Nitrobenzyl)-4-methylpiperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g.
1-methyl-4-[(2-nitrophenyl)methyl]piperazine (CAS 19577-82-3) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: 1-methyl-4-[(2-nitrophenyl)methyl]piperazine. InChIKey: FTWAMEGOZZYQHK-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-methyl-4-[(2-nitrophenyl)methyl]piperazine |
| InChIKey | FTWAMEGOZZYQHK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)