Products 159016-25-8

CAS 159016-25-8 is the registry number for N'-[1-Amino-1-phenylmethylidene]hydrazinecarboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(Z)-[amino(phenyl)methylidene]amino]carbamate (CAS 159016-25-8) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl N-[(Z)-[amino(phenyl)methylidene]amino]carbamate. InChIKey: UUWHNGLXDSXTLN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17N3O2
Molecular weight235.28 g/mol
IUPAC nametert-butyl N-[(Z)-[amino(phenyl)methylidene]amino]carbamate
InChIKeyUUWHNGLXDSXTLN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N/N=C(/C1=CC=CC=C1)\N

Computed by PubChem (NCBI)