cas: 18903-01-0 — see every product listed under this CAS number, including other names
1-(3-Phenyl-2-propenyl)piperazine, 96%, 96% (CAS 18903-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113HQV-100mg |
| cas | 18903-01-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 938.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-[(E)-3-phenylprop-2-enyl]piperazine (CAS 18903-01-0) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: 1-[(E)-3-phenylprop-2-enyl]piperazine. InChIKey: WGEIOMTZIIOUMA-QPJJXVBHSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | 1-[(E)-3-phenylprop-2-enyl]piperazine |
| InChIKey | WGEIOMTZIIOUMA-QPJJXVBHSA-N |
| SMILES | C1CN(CCN1)C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)