CAS 172739-04-7 appears in our catalog under these names: Cis-2-benzyloctahydropyrrolo[3,4-c]pyrrole, 96%, cis–2–Benzylhexahydropyrrolo(3,4–c)pyrrole, cis-2-Benzyloctahydropyrrolo(3,4-c)pyrrole, cis-2-Benzyl-octahydropyrrolo[3,4-c]pyrrole, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 0,25g, 0,5g, 2g, 100mg.
(3aS,6aR)-5-benzyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (CAS 172739-04-7) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: (3aS,6aR)-5-benzyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole. InChIKey: AOBSJQWEYXEPBK-BETUJISGSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | (3aS,6aR)-5-benzyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| InChIKey | AOBSJQWEYXEPBK-BETUJISGSA-N |
| SMILES | C1[C@@H]2CN(C[C@@H]2CN1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)