CAS 370879-92-8 appears in our catalog under these names: Cis-1-benzylhexahydropyrrolo[3,4-b]pyrrole, 95%, cis–1–Benzylhexahydropyrrolo(3,4–b)pyrrole, cis-1-Benzylhexahydropyrrolo(3,4-B)pyrrole. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
(3aR,6aR)-1-benzyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (CAS 370879-92-8) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: (3aR,6aR)-1-benzyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole. InChIKey: LODPYENASSOOBD-OLZOCXBDSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | (3aR,6aR)-1-benzyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| InChIKey | LODPYENASSOOBD-OLZOCXBDSA-N |
| SMILES | C1CN([C@@H]2[C@H]1CNC2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)