1-(4-(1,2,2-Triphenylvinyl)phenyl)-1H-pyrrole-2,5-dione, 97%
cas: 2414485-55-3 — see every product listed under this CAS number, including other names
1-(4-(1,2,2-Triphenylvinyl)phenyl)-1H-pyrrole-2,5-dione, 97% (CAS 2414485-55-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F864933-250MG |
| cas | 2414485-55-3 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 2981.26 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1755.44 Pln | |
| Ambeed | 25g | 6561.44 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2061.20 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 603.15 Pln | |
| BLDpharm | 5g | 1891.58 Pln | |
| BLDpharm | 25g | 7073.09 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-[4-(1,2,2-triphenylethenyl)phenyl]pyrrole-2,5-dione (CAS 2414485-55-3) is a chemical compound with the molecular formula C30H21NO2 and a molecular weight of 427.5 g/mol. IUPAC name: 1-[4-(1,2,2-triphenylethenyl)phenyl]pyrrole-2,5-dione. InChIKey: NWLXXGBCCOHABM-UHFFFAOYSA-N.
| Molecular formula | C30H21NO2 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 1-[4-(1,2,2-triphenylethenyl)phenyl]pyrrole-2,5-dione |
| InChIKey | NWLXXGBCCOHABM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)N4C(=O)C=CC4=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)