CAS 2414485-55-3 appears in our catalog under these names: 1-(4-(1,2,2-Triphenylvinyl)phenyl)-1H-pyrrole-2,5-dione, 97%, 97%, 1-(4-(1,2,2-Triphenylvinyl)phenyl)-1H-pyrrole-2,5-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
1-[4-(1,2,2-triphenylethenyl)phenyl]pyrrole-2,5-dione (CAS 2414485-55-3) is a chemical compound with the molecular formula C30H21NO2 and a molecular weight of 427.5 g/mol. IUPAC name: 1-[4-(1,2,2-triphenylethenyl)phenyl]pyrrole-2,5-dione. InChIKey: NWLXXGBCCOHABM-UHFFFAOYSA-N.
| Molecular formula | C30H21NO2 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 1-[4-(1,2,2-triphenylethenyl)phenyl]pyrrole-2,5-dione |
| InChIKey | NWLXXGBCCOHABM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)N4C(=O)C=CC4=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)