cas: 54549-72-3 — see every product listed under this CAS number, including other names
1-(4-(2-HYDROXYPROPAN-2-YL)PHENYL) ETHANONE, 98% (CAS 54549-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F813142-100MG |
| cas | 54549-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1513.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone (CAS 54549-72-3) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone. InChIKey: KWWWFTBWCKTBQI-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone |
| InChIKey | KWWWFTBWCKTBQI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C)(C)O |
Computed by PubChem (NCBI)