CAS 20430-18-6 appears in our catalog under these names: 2-Methyl-2-(4-methylphenyl)propanoic acid, 95%, 2–methyl–2–(p–tolyl)propanoic acid, 2-Methyl-2-(p-tolyl)propanoic acid, 95%, 95%, 2-Methyl-2-(4-methylphenyl)propanoic acid, 98%, 2-Methyl-2-(p-tolyl)propanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25g, 100mg.
2-methyl-2-(4-methylphenyl)propanoic acid (CAS 20430-18-6) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-methyl-2-(4-methylphenyl)propanoic acid. InChIKey: SHDBWXXRCCHGQD-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-methyl-2-(4-methylphenyl)propanoic acid |
| InChIKey | SHDBWXXRCCHGQD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)