CAS 13490-69-2 appears in our catalog under these names: (S)–3–Methyl–2–phenylbutanoic acid, (S)-3-Methyl-2-phenylbutanoic acid, (S)-3-Methyl-2-phenylbutanoic acid, 95%, (S)-3-Methyl-2-phenylbutanoic acid, 98%, (S)-3-Methyl-2-phenylbutanoic Acid, 98%, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S)-3-methyl-2-phenylbutanoic acid (CAS 13490-69-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: (2S)-3-methyl-2-phenylbutanoic acid. InChIKey: HDLQGISFYDYWFJ-JTQLQIEISA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (2S)-3-methyl-2-phenylbutanoic acid |
| InChIKey | HDLQGISFYDYWFJ-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)