cas: 172739-45-6 — see every product listed under this CAS number, including other names
1-(4-(3-chloropropoxy)-2-hydroxyphenyl)ethanone (CAS 172739-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKKG-100mg |
| cas | 172739-45-6 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1317.20 Pln |
| delivery time | 3 weeks |
|---|
1-[4-(3-chloropropoxy)-2-hydroxyphenyl]ethanone (CAS 172739-45-6) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 1-[4-(3-chloropropoxy)-2-hydroxyphenyl]ethanone. InChIKey: KPADWTIRNNDRIY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 1-[4-(3-chloropropoxy)-2-hydroxyphenyl]ethanone |
| InChIKey | KPADWTIRNNDRIY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OCCCCl)O |
Computed by PubChem (NCBI)