CAS 946762-70-5 is the registry number for 3-(3-Chlorophenoxy)-2,2-dimethylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3-chlorophenoxy)-2,2-dimethylpropanoic acid (CAS 946762-70-5) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 3-(3-chlorophenoxy)-2,2-dimethylpropanoic acid. InChIKey: XHWMOAVPNOQVIS-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 3-(3-chlorophenoxy)-2,2-dimethylpropanoic acid |
| InChIKey | XHWMOAVPNOQVIS-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)