Products 946762-70-5

CAS 946762-70-5 is the registry number for 3-(3-Chlorophenoxy)-2,2-dimethylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3-chlorophenoxy)-2,2-dimethylpropanoic acid (CAS 946762-70-5) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 3-(3-chlorophenoxy)-2,2-dimethylpropanoic acid. InChIKey: XHWMOAVPNOQVIS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO3
Molecular weight228.67 g/mol
IUPAC name3-(3-chlorophenoxy)-2,2-dimethylpropanoic acid
InChIKeyXHWMOAVPNOQVIS-UHFFFAOYSA-N
SMILESCC(C)(COC1=CC(=CC=C1)Cl)C(=O)O

Computed by PubChem (NCBI)