Products 1280786-73-3

CAS 1280786-73-3 is the registry number for 4-Chloro-3-isobutoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-(2-methylpropoxy)benzoic acid (CAS 1280786-73-3) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 4-chloro-3-(2-methylpropoxy)benzoic acid. InChIKey: MIHGERMEJSCGDA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO3
Molecular weight228.67 g/mol
IUPAC name4-chloro-3-(2-methylpropoxy)benzoic acid
InChIKeyMIHGERMEJSCGDA-UHFFFAOYSA-N
SMILESCC(C)COC1=C(C=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)