cas: 1003309-09-8 — see every product listed under this CAS number, including other names
1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyrrolidin-2-one, 97% (CAS 1003309-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616847-100MG |
| cas | 1003309-09-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1434.93 Pln | |
| Fluorochem | 5g | 4277.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one (CAS 1003309-09-8) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one. InChIKey: YYSWCEFASKJARU-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one |
| InChIKey | YYSWCEFASKJARU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCCC3=O |
Computed by PubChem (NCBI)