Products 2490666-10-7
CAS 2490666-10-7 is the registry number for 2-Propoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-propoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2490666-10-7) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: 2-propoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: GXTBCXBFSFHRKY-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 2-propoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | GXTBCXBFSFHRKY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)OCCC |
Computed by PubChem (NCBI)