CAS 2377610-59-6 is the registry number for N-Cyclopropyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2377610-59-6) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: N-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: PZZZQKNUDJPCSM-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | N-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | PZZZQKNUDJPCSM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(=O)NC3CC3 |
Computed by PubChem (NCBI)