cas: 68255-58-3 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione 95% (CAS 68255-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144627-250mg |
| cas | 68255-58-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A144627 |
1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (CAS 68255-58-3) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione. InChIKey: QNYNUXQOTWCDOQ-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| InChIKey | QNYNUXQOTWCDOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)OC(F)(F)F |
Computed by PubChem (NCBI)