cas: 68255-58-3 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione, 95%, 95% (CAS 68255-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116XHA-250mg |
| cas | 68255-58-3 |
| size | 250mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2589.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (CAS 68255-58-3) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione. InChIKey: QNYNUXQOTWCDOQ-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| InChIKey | QNYNUXQOTWCDOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)OC(F)(F)F |
Computed by PubChem (NCBI)