CAS 68255-58-3 appears in our catalog under these names: 1-[4-(Trifluoromethoxy)phenyl]-1H-pyrrole-2,5-dione, 95%, 1-(4-(Trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione, 95%, 95%, 1-[4-(trifluoromethoxy)phenyl]-1H-pyrrole-2,5-dione, 1-(4-(Trifluoromethoxy)phenyl)-1H-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (CAS 68255-58-3) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione. InChIKey: QNYNUXQOTWCDOQ-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| InChIKey | QNYNUXQOTWCDOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)OC(F)(F)F |
Computed by PubChem (NCBI)