cas: 2040-10-0 — see every product listed under this CAS number, including other names
1-(4-(tert-Butyl)-2,6-dimethylphenyl)ethanone, 98%,RG, 98%,RG (CAS 2040-10-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11309H-250mg |
| cas | 2040-10-0 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 100mg | 117.20 Pln |
| purity | 98%,RG |
|---|---|
| delivery time | 3 weeks |
1-(4-tert-butyl-2,6-dimethylphenyl)ethanone (CAS 2040-10-0) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 1-(4-tert-butyl-2,6-dimethylphenyl)ethanone. InChIKey: JNHLHPMTMTYLCP-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 1-(4-tert-butyl-2,6-dimethylphenyl)ethanone |
| InChIKey | JNHLHPMTMTYLCP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)C)C)C(C)(C)C |
Computed by PubChem (NCBI)