CAS 60561-82-2 appears in our catalog under these names: 4'-tert-Butyl-2-methylpropiophenone, 95%, 1-(4-tert-Butylphenyl)-2-methylpropan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(4-tert-butylphenyl)-2-methylpropan-1-one (CAS 60561-82-2) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-methylpropan-1-one. InChIKey: UYSVXJZQVNOLNB-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-methylpropan-1-one |
| InChIKey | UYSVXJZQVNOLNB-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)