CAS 2700-84-7 is the registry number for 1-Mesityl-2,2-dimethylpropan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-1-(2,4,6-trimethylphenyl)propan-1-one (CAS 2700-84-7) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 2,2-dimethyl-1-(2,4,6-trimethylphenyl)propan-1-one. InChIKey: WIJOXYWRGOPMTI-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 2,2-dimethyl-1-(2,4,6-trimethylphenyl)propan-1-one |
| InChIKey | WIJOXYWRGOPMTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C(C)(C)C)C |
Computed by PubChem (NCBI)